cas: 1645275-47-3 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-2-fluorobenzenesulphonamide, 98%, 98% (CAS 1645275-47-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FH0K-250mg |
| cas | 1645275-47-3 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 760.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(bromomethyl)-2-fluorobenzenesulfonamide (CAS 1645275-47-3) is a chemical compound with the molecular formula C7H7BrFNO2S and a molecular weight of 268.11 g/mol. IUPAC name: 4-(bromomethyl)-2-fluorobenzenesulfonamide. InChIKey: MEDZIOXQDCBAHD-UHFFFAOYSA-N.
| Molecular formula | C7H7BrFNO2S |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluorobenzenesulfonamide |
| InChIKey | MEDZIOXQDCBAHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)F)S(=O)(=O)N |
Computed by PubChem (NCBI)