cas: 147497-57-2 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-4'-fluoro-1,1'-biphenyl 95% (CAS 147497-57-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A271553-100mg |
| cas | 147497-57-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1432.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A271553 |
1-(bromomethyl)-4-(4-fluorophenyl)benzene (CAS 147497-57-2) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 1-(bromomethyl)-4-(4-fluorophenyl)benzene. InChIKey: BBPHEOAKLBGRSZ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrF |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(4-fluorophenyl)benzene |
| InChIKey | BBPHEOAKLBGRSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)