CAS 147497-57-2 appears in our catalog under these names: 4-(Bromomethyl)-4'-fluoro-1,1'-biphenyl, 95%, 4–(Bromomethyl)–4'–fluoro–1,1'–biphenyl, 4-(Bromomethyl)-4'-fluoro-1,1'-biphenyl 95%, 4-(BROMOMETHYL)-4'-FLUORO-BIPHENYL, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(bromomethyl)-4-(4-fluorophenyl)benzene (CAS 147497-57-2) is a chemical compound with the molecular formula C13H10BrF and a molecular weight of 265.12 g/mol. IUPAC name: 1-(bromomethyl)-4-(4-fluorophenyl)benzene. InChIKey: BBPHEOAKLBGRSZ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrF |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(4-fluorophenyl)benzene |
| InChIKey | BBPHEOAKLBGRSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)