cas: 1215118-94-7 — see every product listed under this CAS number, including other names
4-(Chloromethyl)-1-isopropoxy-2-(trifluoromethyl)benzene 98% +(stabilized with CaCO3) (CAS 1215118-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1521576-1g |
| cas | 1215118-94-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 10g | 1193.62 Pln | |
| Ambeed | 25g | 2662.12 Pln |
| purity | 98% +(stabilized with CaCO3) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1521576 |
4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene (CAS 1215118-94-7) is a chemical compound with the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. IUPAC name: 4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene. InChIKey: SKOIWBPVBTURJZ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3O |
|---|---|
| Molecular weight | 252.66 g/mol |
| IUPAC name | 4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene |
| InChIKey | SKOIWBPVBTURJZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)CCl)C(F)(F)F |
Computed by PubChem (NCBI)