cas: 1218790-50-1 — see every product listed under this CAS number, including other names
4-(Cyclohexyliminomethyl)phenylboronic acid pinacol ester, 95+%, 95+% (CAS 1218790-50-1) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11270T-5g |
| cas | 1218790-50-1 |
| size | 5g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 587.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 1218790-50-1) is a chemical compound with the molecular formula C19H28BNO2 and a molecular weight of 313.2 g/mol. IUPAC name: N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: BAVKTLABAAKQAH-UHFFFAOYSA-N.
| Molecular formula | C19H28BNO2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | BAVKTLABAAKQAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NC3CCCCC3 |
Computed by PubChem (NCBI)