cas: 1217501-04-6 — see every product listed under this CAS number, including other names
4-(Cyclopropylmethylsulfinyl)phenylboronic acid, 95%, 95% (CAS 1217501-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126RK-250mg |
| cas | 1217501-04-6 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 1g | 2243.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(cyclopropylmethylsulfinyl)phenyl]boronic acid (CAS 1217501-04-6) is a chemical compound with the molecular formula C10H13BO3S and a molecular weight of 224.09 g/mol. IUPAC name: [4-(cyclopropylmethylsulfinyl)phenyl]boronic acid. InChIKey: LVSXKKKBVXTPSI-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3S |
|---|---|
| Molecular weight | 224.09 g/mol |
| IUPAC name | [4-(cyclopropylmethylsulfinyl)phenyl]boronic acid |
| InChIKey | LVSXKKKBVXTPSI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)CC2CC2)(O)O |
Computed by PubChem (NCBI)