CAS 1217501-04-6 appears in our catalog under these names: 4-(Cyclopropylmethylsulfinyl)phenylboronic acid, 95%, (4-((Cyclopropylmethyl)sulfinyl)phenyl)boronic acid, 95%, (4-((Cyclopropylmethyl)sulfinyl)phenyl)boronic acid 95%, 4-(Cyclopropylmethylsulfinyl)phenylboronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg.
[4-(cyclopropylmethylsulfinyl)phenyl]boronic acid (CAS 1217501-04-6) is a chemical compound with the molecular formula C10H13BO3S and a molecular weight of 224.09 g/mol. IUPAC name: [4-(cyclopropylmethylsulfinyl)phenyl]boronic acid. InChIKey: LVSXKKKBVXTPSI-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3S |
|---|---|
| Molecular weight | 224.09 g/mol |
| IUPAC name | [4-(cyclopropylmethylsulfinyl)phenyl]boronic acid |
| InChIKey | LVSXKKKBVXTPSI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)CC2CC2)(O)O |
Computed by PubChem (NCBI)