CAS 2129-31-9 appears in our catalog under these names: 4–(Diphenylphosphino)benzoic Acid, 4-(Diphenylphosphino)benzoic Acid, >97.0%(T)(qNMR), 4-(Diphenylphosphino)benzoic acid, 97%, 4-(Diphenylphosphino)benzoic Acid, 98%+, 98%+, 4-(DIPHENYLPHOSPHINO)BENZOIC ACID, 95%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 50g, 100g.
4-diphenylphosphanylbenzoic acid (CAS 2129-31-9) is a chemical compound with the molecular formula C19H15O2P and a molecular weight of 306.3 g/mol. IUPAC name: 4-diphenylphosphanylbenzoic acid. InChIKey: GXMHDTPYKRTARV-UHFFFAOYSA-N.
| Molecular formula | C19H15O2P |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 4-diphenylphosphanylbenzoic acid |
| InChIKey | GXMHDTPYKRTARV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)