CAS 17261-28-8 appears in our catalog under these names: 2-(Diphenylphosphino)benzoic Acid, >95% (HPLC), 2–(Diphenylphosphino)benzoic acid, 2-(Diphenylphosphino)benzoic Acid, >98.0%(GC)(T), 2-(Diphenylphosphino)benzoic acid, 98%, 2-(DIPHENYLPHOSPHINO)BENZOIC ACID, 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10g, 5g, 25g, 1g, 250g, 100g, 500g, 1000g.
2-diphenylphosphanylbenzoic acid (CAS 17261-28-8) is a chemical compound with the molecular formula C19H15O2P and a molecular weight of 306.3 g/mol. IUPAC name: 2-diphenylphosphanylbenzoic acid. InChIKey: UYRPRYSDOVYCOU-UHFFFAOYSA-N.
| Molecular formula | C19H15O2P |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 2-diphenylphosphanylbenzoic acid |
| InChIKey | UYRPRYSDOVYCOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)