4-(Ethoxymethylene)isoquinoline-1,3(2H,4H)-dione, 95%
cas: 18630-93-8 — see every product listed under this CAS number, including other names
4-(Ethoxymethylene)isoquinoline-1,3(2H,4H)-dione, 95% (CAS 18630-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A418616-100mg |
| cas | 18630-93-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 938.00 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 969.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(ethoxymethylidene)isoquinoline-1,3-dione (CAS 18630-93-8) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 4-(ethoxymethylidene)isoquinoline-1,3-dione. InChIKey: UPFHOYKZRKIAIQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 4-(ethoxymethylidene)isoquinoline-1,3-dione |
| InChIKey | UPFHOYKZRKIAIQ-UHFFFAOYSA-N |
| SMILES | CCOC=C1C2=CC=CC=C2C(=O)NC1=O |
Computed by PubChem (NCBI)
