Products 948293-86-5

CAS 948293-86-5 is the registry number for 5,7-Dimethyl-4-hydroxyquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5,7-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 948293-86-5) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 5,7-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: OSORQRJBQWVNLE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO3
Molecular weight217.22 g/mol
IUPAC name5,7-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid
InChIKeyOSORQRJBQWVNLE-UHFFFAOYSA-N
SMILESCC1=CC(=C2C(=C1)NC=C(C2=O)C(=O)O)C

Computed by PubChem (NCBI)