cas: 955117-56-3 — see every product listed under this CAS number, including other names
4-(Hydroxymethyl)-3-methoxybenzoic acid, 95% (CAS 955117-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-5044-250mg |
| cas | 955117-56-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 500mg | 794.53 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 5808.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(hydroxymethyl)-3-methoxybenzoic acid (CAS 955117-56-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 4-(hydroxymethyl)-3-methoxybenzoic acid. InChIKey: BVTRLERJUCFVNY-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 4-(hydroxymethyl)-3-methoxybenzoic acid |
| InChIKey | BVTRLERJUCFVNY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)CO |
Computed by PubChem (NCBI)