cas: 55843-91-9 — see every product listed under this CAS number, including other names
4-(IMIDAZO[1,2-A]PYRIDIN-2-YL)BENZONITRILE, 98% (CAS 55843-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303600-100MG |
| cas | 55843-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 575.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-imidazo[1,2-a]pyridin-2-ylbenzonitrile (CAS 55843-91-9) is a chemical compound with the molecular formula C14H9N3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-imidazo[1,2-a]pyridin-2-ylbenzonitrile. InChIKey: QKFAADBAQQYFIL-UHFFFAOYSA-N.
| Molecular formula | C14H9N3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-imidazo[1,2-a]pyridin-2-ylbenzonitrile |
| InChIKey | QKFAADBAQQYFIL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)