cas: 389621-80-1 — see every product listed under this CAS number, including other names
4-(N,N-Diethylaminocarbonyl)phenylboronic acid 98% (CAS 389621-80-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273734-1g |
| cas | 389621-80-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1749.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A273734 |
[4-(diethylcarbamoyl)phenyl]boronic acid (CAS 389621-80-1) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [4-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: ZCGVBHIMRVYWOH-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [4-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | ZCGVBHIMRVYWOH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)