cas: 2040476-05-7 — see every product listed under this CAS number, including other names
4-(N,N-Dimethylaminomethyl)-3-fluorophenylboronic acid, pinacol ester, 97%, 97% (CAS 2040476-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I4UK-100mg |
| cas | 2040476-05-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine (CAS 2040476-05-7) is a chemical compound with the molecular formula C15H23BFNO2 and a molecular weight of 279.16 g/mol. IUPAC name: 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine. InChIKey: WLCWSKKTTWXRPG-UHFFFAOYSA-N.
| Molecular formula | C15H23BFNO2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine |
| InChIKey | WLCWSKKTTWXRPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CN(C)C)F |
Computed by PubChem (NCBI)