CAS 2096330-37-7 is the registry number for 2-(Ethylaminomethyl)-5-fluorophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethanamine (CAS 2096330-37-7) is a chemical compound with the molecular formula C15H23BFNO2 and a molecular weight of 279.16 g/mol. IUPAC name: N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethanamine. InChIKey: FHTWGOKAWIFIJZ-UHFFFAOYSA-N.
| Molecular formula | C15H23BFNO2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethanamine |
| InChIKey | FHTWGOKAWIFIJZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CNCC |
Computed by PubChem (NCBI)