cas: 159790-81-5 — see every product listed under this CAS number, including other names
4-(N-Fmoc-aminomethyl)aniline 95% (CAS 159790-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235729-250mg |
| cas | 159790-81-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 25g | 3162.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A235729 |
9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate (CAS 159790-81-5) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate. InChIKey: ZJXNVHARJJXJOW-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate |
| InChIKey | ZJXNVHARJJXJOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)