cas: 1403766-89-1 — see every product listed under this CAS number, including other names
4-(Piperidin-4-yl)thiomorpholine 1,1-dioxide dihydrochloride 98% (CAS 1403766-89-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362489-100mg |
| cas | 1403766-89-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2244.94 Pln | |
| Ambeed | 10g | 3791.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A362489 |
4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride (CAS 1403766-89-1) is a chemical compound with the molecular formula C9H20Cl2N2O2S and a molecular weight of 291.24 g/mol. IUPAC name: 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride. InChIKey: TUOGZOALMDFMOL-UHFFFAOYSA-N.
| Molecular formula | C9H20Cl2N2O2S |
|---|---|
| Molecular weight | 291.24 g/mol |
| IUPAC name | 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide;dihydrochloride |
| InChIKey | TUOGZOALMDFMOL-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2CCS(=O)(=O)CC2.Cl.Cl |
Computed by PubChem (NCBI)