Products 2173052-38-3
CAS 2173052-38-3 is the registry number for (4Ar,7as)-1-propyloctahydrothieno[3,4-b]pyrazine 6,6-dioxide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(4aS,7aR)-4-propyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride (CAS 2173052-38-3) is a chemical compound with the molecular formula C9H20Cl2N2O2S and a molecular weight of 291.24 g/mol. IUPAC name: (4aS,7aR)-4-propyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride. InChIKey: CTLBLVXQWHMCNS-DBEJOZALSA-N.
| Molecular formula | C9H20Cl2N2O2S |
|---|---|
| Molecular weight | 291.24 g/mol |
| IUPAC name | (4aS,7aR)-4-propyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride |
| InChIKey | CTLBLVXQWHMCNS-DBEJOZALSA-N |
| SMILES | CCCN1CCN[C@@H]2[C@H]1CS(=O)(=O)C2.Cl.Cl |
Computed by PubChem (NCBI)