4-(Piperidine-1-carbonyl)phenylboronic acid, 98%
cas: 389621-83-4 — see every product listed under this CAS number, including other names
4-(Piperidine-1-carbonyl)phenylboronic acid, 98% (CAS 389621-83-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg, 10g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | BB-3003-5g |
| cas | 389621-83-4 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 442.09 Pln | |
| BLDpharm | 5g | 1430.63 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1370.00 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 2543.91 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
[4-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 389621-83-4) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: [4-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: PUXUKRSBJVVKMD-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | [4-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | PUXUKRSBJVVKMD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)