cas: 98061-39-3 — see every product listed under this CAS number, including other names
4-(Pyridin-2-yl)benzyl alcohol, 98% (CAS 98061-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F070633-250MG |
| cas | 98061-39-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 2481.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-pyridin-2-ylphenyl)methanol (CAS 98061-39-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanol. InChIKey: BESAKUXOHCFPAA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanol |
| InChIKey | BESAKUXOHCFPAA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)