4-(Trifluoromethyl)-1H-Pyrrole-2-Carboxylic Acid, 97%, 97%
cas: 149427-58-7 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)-1H-Pyrrole-2-Carboxylic Acid, 97%, 97% (CAS 149427-58-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LOR-50mg |
| cas | 149427-58-7 |
| size | 50mg |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 808.40 Pln | |
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 1614.80 Pln | |
| Chemat | 1g | 3952.40 Pln | |
| Chemat | 5g | 17891.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid (CAS 149427-58-7) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid. InChIKey: FZLYSJNODQYBNZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | FZLYSJNODQYBNZ-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)