CAS 149427-58-7 appears in our catalog under these names: 4-(Trifluoromethyl)-1h-pyrrole-2-carboxylic acid, 95%, 4–(Trifluoromethyl)–1H–Pyrrole–2–Carboxylic Acid, 4-(Trifluoromethyl)-1H-pyrrole-2-carboxylic acid, 4-(Trifluoromethyl)-1H-pyrrole-2-carboxylic acid 97%, 4-(Trifluoromethyl)-1H-Pyrrole-2-Carboxylic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g, 5g, 500mg.
4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid (CAS 149427-58-7) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid. InChIKey: FZLYSJNODQYBNZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | FZLYSJNODQYBNZ-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)