cas: 155793-46-7 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)quinolin-3-amine, 95%, 95% (CAS 155793-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112O8B-100mg |
| cas | 155793-46-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2426.00 Pln | |
| Chemat | 250mg | 3842.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethyl)quinolin-3-amine (CAS 155793-46-7) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 4-(trifluoromethyl)quinolin-3-amine. InChIKey: QWTAFNHRDFTUNP-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 4-(trifluoromethyl)quinolin-3-amine |
| InChIKey | QWTAFNHRDFTUNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)