CAS 25371-97-5 is the registry number for 1-(3-Trifluoromethylphenyl)imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-[3-(trifluoromethyl)phenyl]imidazole (CAS 25371-97-5) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]imidazole. InChIKey: KZVUPVJLOACZIL-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]imidazole |
| InChIKey | KZVUPVJLOACZIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CN=C2)C(F)(F)F |
Computed by PubChem (NCBI)