cas: 2426-84-8 — see every product listed under this CAS number, including other names
4-(benzyloxy)-5-methoxy-2-nitrobenzaldehyde, 98% (CAS 2426-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F314956-100MG |
| cas | 2426-84-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 500mg | 487.35 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 2.5g | 1351.63 Pln | |
| Fluorochem | 5g | 2580.36 Pln | |
| Fluorochem | 10g | 4215.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-methoxy-2-nitro-4-phenylmethoxybenzaldehyde (CAS 2426-84-8) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 5-methoxy-2-nitro-4-phenylmethoxybenzaldehyde. InChIKey: WKDLWHKMVQVRNO-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 5-methoxy-2-nitro-4-phenylmethoxybenzaldehyde |
| InChIKey | WKDLWHKMVQVRNO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)