CAS 1035229-31-2 appears in our catalog under these names: 1–(4–(Benzyloxy)–2–hydroxy–3–nitrophenyl)ethanone, 1-(4-(Benzyloxy)-2-hydroxy-3-nitrophenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
1-(2-hydroxy-3-nitro-4-phenylmethoxyphenyl)ethanone (CAS 1035229-31-2) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 1-(2-hydroxy-3-nitro-4-phenylmethoxyphenyl)ethanone. InChIKey: ZTFYNFDZGRLCIS-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 1-(2-hydroxy-3-nitro-4-phenylmethoxyphenyl)ethanone |
| InChIKey | ZTFYNFDZGRLCIS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)OCC2=CC=CC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)