cas: 1256359-83-7 — see every product listed under this CAS number, including other names
4-(t-Butylaminocarbonylmethyl)phenylboronic acid, pinacol ester, 97%, 97% (CAS 1256359-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BRD-100mg |
| cas | 1256359-83-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1256359-83-7) is a chemical compound with the molecular formula C18H28BNO3 and a molecular weight of 317.2 g/mol. IUPAC name: N-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: XRBKWAMLZWELDF-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO3 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | N-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | XRBKWAMLZWELDF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)