CAS 1256359-90-6 is the registry number for 3-(N,N-Diethylcarbamoylmethyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
N,N-diethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1256359-90-6) is a chemical compound with the molecular formula C18H28BNO3 and a molecular weight of 317.2 g/mol. IUPAC name: N,N-diethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: VWXCDGVNMHZMHK-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO3 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | N,N-diethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | VWXCDGVNMHZMHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC(=O)N(CC)CC |
Computed by PubChem (NCBI)