Products 13205-47-5
CAS 13205-47-5 appears in our catalog under these names: 4–tert–Butoxybenzoic Acid, 4-tert-Butoxybenzoic acid, 4-(Tert-Butoxy)Benzoic Acid, 97%, 97%, 4-tert-Butoxybenzoic acid, 98%, 4-(tert-Butoxy)benzoic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 100mg, 250mg, 10g, 25g.
4-[(2-methylpropan-2-yl)oxy]benzoic acid (CAS 13205-47-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]benzoic acid. InChIKey: WHTBQELRENWGTE-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]benzoic acid |
| InChIKey | WHTBQELRENWGTE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)