CAS 1515-20-4 appears in our catalog under these names: 4-tert-Butyl-3-chlorobenzoic acid, 4-(tert-Butyl)-3-chlorobenzoic acid, 95+%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 1g, 250mg, 100mg, 25mg.
4-tert-butyl-3-chlorobenzoic acid (CAS 1515-20-4) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: 4-tert-butyl-3-chlorobenzoic acid. InChIKey: COFPPRDWGOZYBP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 4-tert-butyl-3-chlorobenzoic acid |
| InChIKey | COFPPRDWGOZYBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)