cas: 90525-37-4 — see every product listed under this CAS number, including other names
4-(trans-4-Heptylcyclohexyl)phenol, 98% (CAS 90525-37-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F555852-5G |
| cas | 90525-37-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-heptylcyclohexyl)phenol (CAS 90525-37-4) is a chemical compound with the molecular formula C19H30O and a molecular weight of 274.4 g/mol. IUPAC name: 4-(4-heptylcyclohexyl)phenol. InChIKey: LQNATOSZMJPGNE-UHFFFAOYSA-N.
| Molecular formula | C19H30O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-(4-heptylcyclohexyl)phenol |
| InChIKey | LQNATOSZMJPGNE-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1CCC(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)