CAS 93892-40-1 is the registry number for 4,6-Diisopropyl-1,1,3,3-tetramethyl-5-indanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,3,3-tetramethyl-4,6-di(propan-2-yl)-2H-inden-5-ol (CAS 93892-40-1) is a chemical compound with the molecular formula C19H30O and a molecular weight of 274.4 g/mol. IUPAC name: 1,1,3,3-tetramethyl-4,6-di(propan-2-yl)-2H-inden-5-ol. InChIKey: WGQDDNQFNLMBOS-UHFFFAOYSA-N.
| Molecular formula | C19H30O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 1,1,3,3-tetramethyl-4,6-di(propan-2-yl)-2H-inden-5-ol |
| InChIKey | WGQDDNQFNLMBOS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C(=C1O)C(C)C)C(CC2(C)C)(C)C |
Computed by PubChem (NCBI)