CAS 127971-53-3 appears in our catalog under these names: 2-Methyl-3,5-dinitro-4-[(pentan-3-yl)amino]benzoic acid, 95%, 4-((1-Ethylpropyl)amino)-2-methyl-3,5-dinitro-benzoic Acid, >95% (HPLC), 4–((1–Ethylpropyl) amino)–2–methyl–3,5–dinitrobenzoic acid, 4-[(1-Ethylpropyl)amino]-2-methyl-3,5-dinitrobenzoic acid, 95%, 95%, 4-[(1-Ethylpropyl)amino]-2-methyl-3,5-dinitro-benzoic acid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, TRC, GLPBio, Chemat, HPC Standards. Available pack sizes: 1g, 250mg, 100mg, 10mg, 1x1ml.
2-methyl-3,5-dinitro-4-(pentan-3-ylamino)benzoic acid (CAS 127971-53-3) is a chemical compound with the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. IUPAC name: 2-methyl-3,5-dinitro-4-(pentan-3-ylamino)benzoic acid. InChIKey: OYOCXOGNLMMZMC-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O6 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-methyl-3,5-dinitro-4-(pentan-3-ylamino)benzoic acid |
| InChIKey | OYOCXOGNLMMZMC-UHFFFAOYSA-N |
| SMILES | CCC(CC)NC1=C(C=C(C(=C1[N+](=O)[O-])C)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)