cas: 1158365-82-2 — see every product listed under this CAS number, including other names
4-[(4-Aminopiperidin-1-yl)methyl]benzonitrile dihydrochloride (CAS 1158365-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F064194-250MG |
| cas | 1158365-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2189.87 Pln | |
| Fluorochem | 1g | 4246.44 Pln |
| delivery time | 3-4 weeks |
|---|
4-[(4-aminopiperidin-1-yl)methyl]benzonitrile;dihydrochloride (CAS 1158365-82-2) is a chemical compound with the molecular formula C13H19Cl2N3 and a molecular weight of 288.21 g/mol. IUPAC name: 4-[(4-aminopiperidin-1-yl)methyl]benzonitrile;dihydrochloride. InChIKey: PEYNABVSERZDTP-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2N3 |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | 4-[(4-aminopiperidin-1-yl)methyl]benzonitrile;dihydrochloride |
| InChIKey | PEYNABVSERZDTP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC=C(C=C2)C#N.Cl.Cl |
Computed by PubChem (NCBI)