CAS 1158326-68-1 appears in our catalog under these names: 2-Cyclohexyl-1h-1,3-benzodiazol-5-amine dihydrochloride, 95%, 2-Cyclohexyl-1H-benzo(d)imidazol-5-amine dihydrochloride, 98%, 2-Cyclohexyl-1H-1,3-benzodiazol-5-amine dihydrochloride, 2-Cyclohexyl-1h-1,3-benzodiazol-5-amine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 100mg, 1g, 2,5g.
2-cyclohexyl-3H-benzimidazol-5-amine;dihydrochloride (CAS 1158326-68-1) is a chemical compound with the molecular formula C13H19Cl2N3 and a molecular weight of 288.21 g/mol. IUPAC name: 2-cyclohexyl-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: OYXPINBAQOCLKI-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2N3 |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | 2-cyclohexyl-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | OYXPINBAQOCLKI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(N2)C=C(C=C3)N.Cl.Cl |
Computed by PubChem (NCBI)