cas: 486422-68-8 — see every product listed under this CAS number, including other names
4-[(Morpholin-4-yl)sulphonyl]benzeneboronic acid 97% (CAS 486422-68-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282191-250mg |
| cas | 486422-68-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A282191 |
(4-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 486422-68-8) is a chemical compound with the molecular formula C10H14BNO5S and a molecular weight of 271.10 g/mol. IUPAC name: (4-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: BRRALDPVXKGEEE-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO5S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | (4-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | BRRALDPVXKGEEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)