cas: 1375064-52-0 — see every product listed under this CAS number, including other names
4-[3-(Methoxycarbonyl)-5-isoxazolyl]benzoic Acid, ≥95%, ≥95% (CAS 1375064-52-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124F7-100mg |
| cas | 1375064-52-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 2267.60 Pln | |
| Chemat | 5g | 10398.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-(3-methoxycarbonyl-1,2-oxazol-5-yl)benzoic acid (CAS 1375064-52-0) is a chemical compound with the molecular formula C12H9NO5 and a molecular weight of 247.20 g/mol. IUPAC name: 4-(3-methoxycarbonyl-1,2-oxazol-5-yl)benzoic acid. InChIKey: YGJBDODYBMPATP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5 |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 4-(3-methoxycarbonyl-1,2-oxazol-5-yl)benzoic acid |
| InChIKey | YGJBDODYBMPATP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)