CAS 153646-24-3 appears in our catalog under these names: Methyl 3-(1,3-dioxo-2,3-dihydro-1h-isoindol-2-yl)-2-oxopropanoate, 95%, Methyl 3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)-2-oxopropanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 3-(1,3-dioxoisoindol-2-yl)-2-oxopropanoate (CAS 153646-24-3) is a chemical compound with the molecular formula C12H9NO5 and a molecular weight of 247.20 g/mol. IUPAC name: methyl 3-(1,3-dioxoisoindol-2-yl)-2-oxopropanoate. InChIKey: CRFRUUGFDCLUOV-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5 |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | methyl 3-(1,3-dioxoisoindol-2-yl)-2-oxopropanoate |
| InChIKey | CRFRUUGFDCLUOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)