cas: 396129-66-1 — see every product listed under this CAS number, including other names
4-{3-[4-(Trifluoromethyl)phenyl]-1H-pyrazol-4-yl}pyridine (CAS 396129-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023740-1G |
| cas | 396129-66-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1690.05 Pln | |
| Fluorochem | 5g | 5423.11 Pln | |
| Fluorochem | 10g | 9749.71 Pln |
| delivery time | 2-3 weeks |
|---|
4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine (CAS 396129-66-1) is a chemical compound with the molecular formula C15H10F3N3 and a molecular weight of 289.25 g/mol. IUPAC name: 4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine. InChIKey: SHOMSTGDXQQIQN-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | 4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine |
| InChIKey | SHOMSTGDXQQIQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C3=CC=NC=C3)C(F)(F)F |
Computed by PubChem (NCBI)