CAS 396129-66-1 appears in our catalog under these names: 4-(3-[4-(Trifluoromethyl)phenyl]-1h-pyrazol-4-yl)-pyridine, 95%, 4-{3-[4-(Trifluoromethyl)phenyl]-1H-pyrazol-4-yl}pyridine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g.
4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine (CAS 396129-66-1) is a chemical compound with the molecular formula C15H10F3N3 and a molecular weight of 289.25 g/mol. IUPAC name: 4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine. InChIKey: SHOMSTGDXQQIQN-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | 4-[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]pyridine |
| InChIKey | SHOMSTGDXQQIQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C3=CC=NC=C3)C(F)(F)F |
Computed by PubChem (NCBI)