cas: 1114822-42-2 — see every product listed under this CAS number, including other names
4-AMINO-1-[(2-CHLOROPHENYL)METHYL]PYRROLIDIN-2-ONE, 97% (CAS 1114822-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502122-100MG |
| cas | 1114822-42-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 500mg | 924.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one (CAS 1114822-42-2) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one. InChIKey: UHISTAFNTIFXHV-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one |
| InChIKey | UHISTAFNTIFXHV-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)