CAS 1638744-58-7 is the registry number for (4S)-4-Amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(4S)-4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one (CAS 1638744-58-7) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: (4S)-4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one. InChIKey: UHISTAFNTIFXHV-VIFPVBQESA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | (4S)-4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one |
| InChIKey | UHISTAFNTIFXHV-VIFPVBQESA-N |
| SMILES | C1[C@@H](CN(C1=O)CC2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)