cas: 10315-03-4 — see every product listed under this CAS number, including other names
4-Acetyl-4-phenylpiperidine hydrochloride, 99% (CAS 10315-03-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 134580050 |
| cas | 10315-03-4 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 712.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1-(4-phenylpiperidin-4-yl)ethanone;hydrochloride (CAS 10315-03-4) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 1-(4-phenylpiperidin-4-yl)ethanone;hydrochloride. InChIKey: JYDHZOIDIWUHDB-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 1-(4-phenylpiperidin-4-yl)ethanone;hydrochloride |
| InChIKey | JYDHZOIDIWUHDB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(CCNCC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)