cas: 170921-49-0 — see every product listed under this CAS number, including other names
4-Amino-1-benzylpiperidine-4-carboxamide 98% (CAS 170921-49-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A522555-10g |
| cas | 170921-49-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A522555 |
4-amino-1-benzylpiperidine-4-carboxamide (CAS 170921-49-0) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 4-amino-1-benzylpiperidine-4-carboxamide. InChIKey: YITYNCSQCPGDGO-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-amino-1-benzylpiperidine-4-carboxamide |
| InChIKey | YITYNCSQCPGDGO-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C(=O)N)N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)