CAS 950-58-3 appears in our catalog under these names: 4-Amino-2,6-di-tert-butylphenol, 95%, 4–Amino–2,6–di–tert–butylphenol, 4-Amino-2,6-di-tert-butylphenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
4-amino-2,6-ditert-butylphenol (CAS 950-58-3) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: 4-amino-2,6-ditert-butylphenol. InChIKey: MNDTVJMRXYKBPV-UHFFFAOYSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | 4-amino-2,6-ditert-butylphenol |
| InChIKey | MNDTVJMRXYKBPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)N |
Computed by PubChem (NCBI)