Products 873055-58-4
CAS 873055-58-4 appears in our catalog under these names: 5-Amino-2,4-di-tert-butylphenol, 98%, Ivacaftor Impurity 7, 5-Amino-2,4-di-tert-butylphenol 95%, 5-Amino-2,4-bis(1,1-dimethylethyl)phenol, 95%, 95%, 5-AMINO-2,4-DI-TERT-BUTYLPHENOL, 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, on request, 250mg, 100g.
5-amino-2,4-ditert-butylphenol (CAS 873055-58-4) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: 5-amino-2,4-ditert-butylphenol. InChIKey: BKSDHPHOWDUJNB-UHFFFAOYSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | 5-amino-2,4-ditert-butylphenol |
| InChIKey | BKSDHPHOWDUJNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1N)O)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
5-amino-2,4-di-tert-butylphenol, 5-Amino-2,4-bis(1,1-dimethylethyl)phenol, Phenol, 5-amino-2,4-bis(1,1-dimethylethyl)-, 5-amino-2,4-ditert-butylphenol, 5-Amino-2,4-di-tert-butyl-phenol, 5-amino-2,4-ditert-butyl-phenol, Ivacaftor Impurity 10, 5-amino-2,4-di-tert-butyl phenol, 4,6-dichloropyridazin-4-ol, 5-amino-2,4-di-t-butylphenol