cas: 1535-76-8 — see every product listed under this CAS number, including other names
4-Amino-2-(trifluoromethyl)phenol 96% (CAS 1535-76-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750697-100mg |
| cas | 1535-76-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1199.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750697 |
4-amino-2-(trifluoromethyl)phenol (CAS 1535-76-8) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: 4-amino-2-(trifluoromethyl)phenol. InChIKey: OHNDAXCVWUKVHF-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | 4-amino-2-(trifluoromethyl)phenol |
| InChIKey | OHNDAXCVWUKVHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)O |
Computed by PubChem (NCBI)