cas: 39150-45-3 — see every product listed under this CAS number, including other names
4-Amino-3,5-dibromobenzenesulfonamide 97% (CAS 39150-45-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1471522-5g |
| cas | 39150-45-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 359.25 Pln | |
| Ambeed | 100g | 909.94 Pln | |
| Ambeed | 500g | 4152.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1471522 |
4-amino-3,5-dibromobenzenesulfonamide (CAS 39150-45-3) is a chemical compound with the molecular formula C6H6Br2N2O2S and a molecular weight of 330.00 g/mol. IUPAC name: 4-amino-3,5-dibromobenzenesulfonamide. InChIKey: DLXJPWSYRLLYSV-UHFFFAOYSA-N.
| Molecular formula | C6H6Br2N2O2S |
|---|---|
| Molecular weight | 330.00 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzenesulfonamide |
| InChIKey | DLXJPWSYRLLYSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)