cas: 37148-47-3 — see every product listed under this CAS number, including other names
4-Amino-3,5-dichlorophenacylbromide, 95%, 95% (CAS 37148-47-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7MQ-5g |
| cas | 37148-47-3 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 798.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-amino-3,5-dichlorophenyl)-2-bromoethanone (CAS 37148-47-3) is a chemical compound with the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-bromoethanone. InChIKey: ATKJJUFAWYSFID-UHFFFAOYSA-N.
| Molecular formula | C8H6BrCl2NO |
|---|---|
| Molecular weight | 282.95 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-bromoethanone |
| InChIKey | ATKJJUFAWYSFID-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C(=O)CBr |
Computed by PubChem (NCBI)